C14H32N4O6P2 — CID 22495507
2-[10-(2-phosphonoethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]ethylphosphonic acid (PubChem CID 22495507) has the molecular formula C14H32N4O6P2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 2-[10-(2-phosphonoethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]ethylphosphonic acid.
| Compound Name | 2-[10-(2-phosphonoethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 22495507 |
| Molecular Formula | C14H32N4O6P2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[10-(2-phosphonoethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCN1CCN2CCN(CC1)CCN(CCP(=O)(O)O)CC2 |
| InChI | InChI=1S/C14H32N4O6P2/c19-25(20,21)13-11-17-7-3-15-1-2-16(5-9-17)6-10-18(8-4-15)12-14-26(22,23)24/h1-14H2,(H2,19,20,21)(H2,22,23,24) |
| InChIKey | QMWJTMFUSMFHAW-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|