C8H18NO5P — CID 142702134
2-[3-hydroxy-5-(hydroxymethyl)piperidin-1-yl]ethylphosphonic acid (PubChem CID 142702134) has the molecular formula C8H18NO5P and a molecular weight of 239.21 g/mol. Its IUPAC name is 2-[3-hydroxy-5-(hydroxymethyl)piperidin-1-yl]ethylphosphonic acid.
| Compound Name | 2-[3-hydroxy-5-(hydroxymethyl)piperidin-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 142702134 |
| Molecular Formula | C8H18NO5P |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-[3-hydroxy-5-(hydroxymethyl)piperidin-1-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCN1CC(O)CC(CO)C1 |
| InChI | InChI=1S/C8H18NO5P/c10-6-7-3-8(11)5-9(4-7)1-2-15(12,13)14/h7-8,10-11H,1-6H2,(H2,12,13,14) |
| InChIKey | JUGRDHQUHKHUOB-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|