C8H19NO2 — CID 142979346
ethane;(3R,5R)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol (PubChem CID 142979346) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is ethane;(3R,5R)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol.
| Compound Name | ethane;(3R,5R)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 142979346 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | ethane;(3R,5R)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol |
| SMILES | CC.CN1C[C@H](O)C[C@@H]1CO |
| InChI | InChI=1S/C6H13NO2.C2H6/c1-7-3-6(9)2-5(7)4-8;1-2/h5-6,8-9H,2-4H2,1H3;1-2H3/t5-,6-;/m1./s1 |
| InChIKey | UVEJZHNFZCZDAW-KGZKBUQUSA-N |
| XLogP | 0.07 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |