C7H14BNOS — CID 59969699
CID 59969699 (PubChem CID 59969699) has the molecular formula C7H14BNOS and a molecular weight of 171.07 g/mol.
| Compound Name | CID 59969699 |
|---|---|
| PubChem CID | 59969699 |
| Molecular Formula | C7H14BNOS |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | — |
| SMILES | [B]CSC[C@@H]1C[C@H](O)CN1C |
| InChI | InChI=1S/C7H14BNOS/c1-9-3-7(10)2-6(9)4-11-5-8/h6-7,10H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | LTLQSTMFPKASOV-BQBZGAKWSA-N |
| XLogP | -0.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|