C14H19N6O3P — CID 138468227
2-[4-(6-pyrimidin-4-ylpyrimidin-4-yl)piperazin-1-yl]ethylphosphonic acid (PubChem CID 138468227) has the molecular formula C14H19N6O3P and a molecular weight of 350.32 g/mol. Its IUPAC name is 2-[4-(6-pyrimidin-4-ylpyrimidin-4-yl)piperazin-1-yl]ethylphosphonic acid.
| Compound Name | 2-[4-(6-pyrimidin-4-ylpyrimidin-4-yl)piperazin-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 138468227 |
| Molecular Formula | C14H19N6O3P |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[4-(6-pyrimidin-4-ylpyrimidin-4-yl)piperazin-1-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCN1CCN(c2cc(-c3ccncn3)ncn2)CC1 |
| InChI | InChI=1S/C14H19N6O3P/c21-24(22,23)8-7-19-3-5-20(6-4-19)14-9-13(17-11-18-14)12-1-2-15-10-16-12/h1-2,9-11H,3-8H2,(H2,21,22,23) |
| InChIKey | HMULSGDJMNALIQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|