C19H17Cl2N5 — CID 24964054
4-(2,4-dichlorophenyl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidine (PubChem CID 24964054) has the molecular formula C19H17Cl2N5 and a molecular weight of 386.29 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-(2,4-dichlorophenyl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 24964054 |
| Molecular Formula | C19H17Cl2N5 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidine |
| SMILES | Clc1ccc(-c2cc(N3CCN(c4ccncc4)CC3)ncn2)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N5/c20-14-1-2-16(17(21)11-14)18-12-19(24-13-23-18)26-9-7-25(8-10-26)15-3-5-22-6-4-15/h1-6,11-13H,7-10H2 |
| InChIKey | JNTHKMXBVCQWOS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |