C11H26N2O6P2 — CID 162251792
1-pyrrolidin-1-ylethylphosphonic acid;pyrrolidin-1-ylmethylphosphonic acid (PubChem CID 162251792) has the molecular formula C11H26N2O6P2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylethylphosphonic acid;pyrrolidin-1-ylmethylphosphonic acid.
| Compound Name | 1-pyrrolidin-1-ylethylphosphonic acid;pyrrolidin-1-ylmethylphosphonic acid |
|---|---|
| PubChem CID | 162251792 |
| Molecular Formula | C11H26N2O6P2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-pyrrolidin-1-ylethylphosphonic acid;pyrrolidin-1-ylmethylphosphonic acid |
| SMILES | CC(N1CCCC1)P(=O)(O)O.O=P(O)(O)CN1CCCC1 |
| InChI | InChI=1S/C6H14NO3P.C5H12NO3P/c1-6(11(8,9)10)7-4-2-3-5-7;7-10(8,9)5-6-3-1-2-4-6/h6H,2-5H2,1H3,(H2,8,9,10);1-5H2,(H2,7,8,9) |
| InChIKey | ZYBWNQTYFDNLOW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|