C9H19N2O6P — CID 88802537
2-hydroxy-2-oxo-N-(phosphonomethyl)-N-(1-pyrrolidin-1-ylethyl)ethanamine oxide (PubChem CID 88802537) has the molecular formula C9H19N2O6P and a molecular weight of 282.23 g/mol. Its IUPAC name is 2-hydroxy-2-oxo-N-(phosphonomethyl)-N-(1-pyrrolidin-1-ylethyl)ethanamine oxide.
| Compound Name | 2-hydroxy-2-oxo-N-(phosphonomethyl)-N-(1-pyrrolidin-1-ylethyl)ethanamine oxide |
|---|---|
| PubChem CID | 88802537 |
| Molecular Formula | C9H19N2O6P |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-hydroxy-2-oxo-N-(phosphonomethyl)-N-(1-pyrrolidin-1-ylethyl)ethanamine oxide |
| SMILES | CC(N1CCCC1)[N+]([O-])(CC(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C9H19N2O6P/c1-8(10-4-2-3-5-10)11(14,6-9(12)13)7-18(15,16)17/h8H,2-7H2,1H3,(H,12,13)(H2,15,16,17) |
| InChIKey | HCROVRWCOUUGAO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|