C8H16NO8P — CID 88802853
N-(carboxymethyl)-1-ethoxy-1-oxo-N-(phosphonomethyl)propan-2-amine oxide (PubChem CID 88802853) has the molecular formula C8H16NO8P and a molecular weight of 285.19 g/mol. Its IUPAC name is N-(carboxymethyl)-1-ethoxy-1-oxo-N-(phosphonomethyl)propan-2-amine oxide.
| Compound Name | N-(carboxymethyl)-1-ethoxy-1-oxo-N-(phosphonomethyl)propan-2-amine oxide |
|---|---|
| PubChem CID | 88802853 |
| Molecular Formula | C8H16NO8P |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-(carboxymethyl)-1-ethoxy-1-oxo-N-(phosphonomethyl)propan-2-amine oxide |
| SMILES | CCOC(=O)C(C)[N+]([O-])(CC(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H16NO8P/c1-3-17-8(12)6(2)9(13,4-7(10)11)5-18(14,15)16/h6H,3-5H2,1-2H3,(H,10,11)(H2,14,15,16) |
| InChIKey | DZIHAQZXDUURBX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|