C14H32GeNO2P — CID 3581218
piperidin-1-ylmethyl(2-triethylgermylethyl)phosphinic acid (PubChem CID 3581218) has the molecular formula C14H32GeNO2P and a molecular weight of 350.00 g/mol. Its IUPAC name is piperidin-1-ylmethyl(2-triethylgermylethyl)phosphinic acid.
| Compound Name | piperidin-1-ylmethyl(2-triethylgermylethyl)phosphinic acid |
|---|---|
| PubChem CID | 3581218 |
| Molecular Formula | C14H32GeNO2P |
| Molecular Weight | 350.00 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | piperidin-1-ylmethyl(2-triethylgermylethyl)phosphinic acid |
| SMILES | CC[Ge](CC)(CC)CCP(=O)(O)CN1CCCCC1 |
| InChI | InChI=1S/C14H32GeNO2P/c1-4-15(5-2,6-3)10-13-19(17,18)14-16-11-8-7-9-12-16/h4-14H2,1-3H3,(H,17,18) |
| InChIKey | UFCXVJPRHCMCCL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.00 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|