C18H38N3O10P3 — CID 159982674
3-[[4-[[2-formyloxyethyl(hydroxy)phosphoryl]methyl]-7-[[hydroxy(propyl)phosphoryl]methyl]-1,4,7-triazonan-1-yl]methyl-hydroxyphosphoryl]propanoic acid (PubChem CID 159982674) has the molecular formula C18H38N3O10P3 and a molecular weight of 549.44 g/mol. Its IUPAC name is 3-[[4-[[2-formyloxyethyl(hydroxy)phosphoryl]methyl]-7-[[hydroxy(propyl)phosphoryl]methyl]-1,4,7-triazonan-1-yl]methyl-hydroxyphosphoryl]propanoic acid.
| Compound Name | 3-[[4-[[2-formyloxyethyl(hydroxy)phosphoryl]methyl]-7-[[hydroxy(propyl)phosphoryl]methyl]-1,4,7-triazonan-1-yl]methyl-hydroxyphosphoryl]propanoic acid |
|---|---|
| PubChem CID | 159982674 |
| Molecular Formula | C18H38N3O10P3 |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 3-[[4-[[2-formyloxyethyl(hydroxy)phosphoryl]methyl]-7-[[hydroxy(propyl)phosphoryl]methyl]-1,4,7-triazonan-1-yl]methyl-hydroxyphosphoryl]propanoic acid |
| SMILES | CCCP(=O)(O)CN1CCN(CP(=O)(O)CCOC=O)CCN(CP(=O)(O)CCC(=O)O)CC1 |
| InChI | InChI=1S/C18H38N3O10P3/c1-2-11-32(25,26)14-19-4-6-20(15-33(27,28)12-3-18(23)24)7-9-21(8-5-19)16-34(29,30)13-10-31-17-22/h17H,2-16H2,1H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | UAYNSOATJNOQFM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 185.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|