6-formyloxyhexanoic acid

C7H12O4 — CID 15269375

IUPAC6-formyloxyhexanoic acid
SMILESO=COCCCCCC(=O)O
InChIInChI=1S/C7H12O4/c8-6-11-5-3-1-2-4-7(9)10/h6H,1-5H2,(H,9,10)
InChIKeyHGAWMSZTNBBHPU-UHFFFAOYSA-N
MW160.17 g/mol
LogP0.80
Rot. Bonds7

About 6-formyloxyhexanoic acid

6-formyloxyhexanoic acid (PubChem CID 15269375) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-formyloxyhexanoic acid.

Molecular Properties

Compound Name6-formyloxyhexanoic acid
PubChem CID15269375
Molecular FormulaC7H12O4
Molecular Weight160.17 g/mol
Exact Mass160.07
IUPAC Name6-formyloxyhexanoic acid
SMILESO=COCCCCCC(=O)O
InChIInChI=1S/C7H12O4/c8-6-11-5-3-1-2-4-7(9)10/h6H,1-5H2,(H,9,10)
InChIKeyHGAWMSZTNBBHPU-UHFFFAOYSA-N
XLogP0.80
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-formyloxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-formyloxyhexanoic acid?
The IUPAC name of 6-formyloxyhexanoic acid (CID 15269375) is 6-formyloxyhexanoic acid.
What is the SMILES notation for 6-formyloxyhexanoic acid?
The canonical SMILES for 6-formyloxyhexanoic acid is O=COCCCCCC(=O)O.
What is the InChIKey of 6-formyloxyhexanoic acid?
The InChIKey is HGAWMSZTNBBHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c8-6-11-5-3-1-2-4-7(9)10/h6H,1-5H2,(H,9,10).
What are the key properties of 6-formyloxyhexanoic acid?
6-formyloxyhexanoic acid has a molecular weight of 160.17 g/mol, XLogP of 0.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-formyloxyhexanoic acid is sourced from PubChem (CID 15269375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).