About (7-oxo-7-phenylheptyl) formate
(7-oxo-7-phenylheptyl) formate (PubChem CID 87851499) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is (7-oxo-7-phenylheptyl) formate.
Molecular Properties
| Compound Name | (7-oxo-7-phenylheptyl) formate |
| PubChem CID | 87851499 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (7-oxo-7-phenylheptyl) formate |
| SMILES | O=COCCCCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3/c15-12-17-11-7-2-1-6-10-14(16)13-8-4-3-5-9-13/h3-5,8-9,12H,1-2,6-7,10-11H2 |
| InChIKey | NOIVDMDFWDSBMT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (7-oxo-7-phenylheptyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-oxo-7-phenylheptyl) formate?
The IUPAC name of (7-oxo-7-phenylheptyl) formate (CID 87851499) is (7-oxo-7-phenylheptyl) formate.
What is the SMILES notation for (7-oxo-7-phenylheptyl) formate?
The canonical SMILES for (7-oxo-7-phenylheptyl) formate is O=COCCCCCCC(=O)c1ccccc1.
What is the InChIKey of (7-oxo-7-phenylheptyl) formate?
The InChIKey is NOIVDMDFWDSBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c15-12-17-11-7-2-1-6-10-14(16)13-8-4-3-5-9-13/h3-5,8-9,12H,1-2,6-7,10-11H2.
What are the key properties of (7-oxo-7-phenylheptyl) formate?
(7-oxo-7-phenylheptyl) formate has a molecular weight of 234.30 g/mol, XLogP of 2.99, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-oxo-7-phenylheptyl) formate is sourced from PubChem (CID 87851499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).