C14H24O8 — CID 59035262
4-[5-(3-formyloxypropoxymethoxy)pentanoyloxy]butanoic acid (PubChem CID 59035262) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-[5-(3-formyloxypropoxymethoxy)pentanoyloxy]butanoic acid.
| Compound Name | 4-[5-(3-formyloxypropoxymethoxy)pentanoyloxy]butanoic acid |
|---|---|
| PubChem CID | 59035262 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-[5-(3-formyloxypropoxymethoxy)pentanoyloxy]butanoic acid |
| SMILES | O=COCCCOCOCCCCC(=O)OCCCC(=O)O |
| InChI | InChI=1S/C14H24O8/c15-11-19-8-4-9-21-12-20-7-2-1-6-14(18)22-10-3-5-13(16)17/h11H,1-10,12H2,(H,16,17) |
| InChIKey | LGCYXOQTSFPYPD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|