C33H52O20 — CID 59663978
5-[2-[2,2-bis[2-(4-carboxybutanoyloxy)ethoxymethyl]-3-[2-(4-formyloxybutanoyloxy)ethoxy]propoxy]ethoxy]-5-oxopentanoic acid (PubChem CID 59663978) has the molecular formula C33H52O20 and a molecular weight of 768.76 g/mol. Its IUPAC name is 5-[2-[2,2-bis[2-(4-carboxybutanoyloxy)ethoxymethyl]-3-[2-(4-formyloxybutanoyloxy)ethoxy]propoxy]ethoxy]-5-oxopentanoic acid.
| Compound Name | 5-[2-[2,2-bis[2-(4-carboxybutanoyloxy)ethoxymethyl]-3-[2-(4-formyloxybutanoyloxy)ethoxy]propoxy]ethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 59663978 |
| Molecular Formula | C33H52O20 |
| Molecular Weight | 768.76 g/mol |
| Exact Mass | 768.31 |
| IUPAC Name | 5-[2-[2,2-bis[2-(4-carboxybutanoyloxy)ethoxymethyl]-3-[2-(4-formyloxybutanoyloxy)ethoxy]propoxy]ethoxy]-5-oxopentanoic acid |
| SMILES | O=COCCCC(=O)OCCOCC(COCCOC(=O)CCCC(=O)O)(COCCOC(=O)CCCC(=O)O)COCCOC(=O)CCCC(=O)O |
| InChI | InChI=1S/C33H52O20/c34-25-49-12-4-11-32(44)53-20-16-48-24-33(21-45-13-17-50-29(41)8-1-5-26(35)36,22-46-14-18-51-30(42)9-2-6-27(37)38)23-47-15-19-52-31(43)10-3-7-28(39)40/h25H,1-24H2,(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | PZKVGFFWHZAUJG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 280.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.76 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|