C20H38O8 — CID 87209999
6-[2-(2,2-dibutoxy-2-ethoxyethoxy)ethoxy]-6-oxohexanoic acid (PubChem CID 87209999) has the molecular formula C20H38O8 and a molecular weight of 406.52 g/mol. Its IUPAC name is 6-[2-(2,2-dibutoxy-2-ethoxyethoxy)ethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[2-(2,2-dibutoxy-2-ethoxyethoxy)ethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87209999 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 6-[2-(2,2-dibutoxy-2-ethoxyethoxy)ethoxy]-6-oxohexanoic acid |
| SMILES | CCCCOC(COCCOC(=O)CCCCC(=O)O)(OCC)OCCCC |
| InChI | InChI=1S/C20H38O8/c1-4-7-13-27-20(26-6-3,28-14-8-5-2)17-24-15-16-25-19(23)12-10-9-11-18(21)22/h4-17H2,1-3H3,(H,21,22) |
| InChIKey | YDJLDWOEYATUND-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|