About butyl hexadecanoate;octadecanoic acid
butyl hexadecanoate;octadecanoic acid (PubChem CID 87698392) has the molecular formula C38H76O4
and a molecular weight of 597.02 g/mol. Its IUPAC name is butyl hexadecanoate;octadecanoic acid.
Molecular Properties
| Compound Name | butyl hexadecanoate;octadecanoic acid |
| PubChem CID | 87698392 |
| Molecular Formula | C38H76O4 |
| Molecular Weight | 597.02 g/mol |
| Exact Mass | 596.57 |
| IUPAC Name | butyl hexadecanoate;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCCCC.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H40O2.C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20(21)22-19-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-19H2,1-2H3;2-17H2,1H3,(H,19,20) |
| InChIKey | WGLDBKOBQXDZSS-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.02 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl hexadecanoate;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl hexadecanoate;octadecanoic acid?
The IUPAC name of butyl hexadecanoate;octadecanoic acid (CID 87698392) is butyl hexadecanoate;octadecanoic acid.
What is the SMILES notation for butyl hexadecanoate;octadecanoic acid?
The canonical SMILES for butyl hexadecanoate;octadecanoic acid is CCCCCCCCCCCCCCCC(=O)OCCCC.CCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of butyl hexadecanoate;octadecanoic acid?
The InChIKey is WGLDBKOBQXDZSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O2.C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20(21)22-19-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-19H2,1-2H3;2-17H2,1H3,(H,19,20).
What are the key properties of butyl hexadecanoate;octadecanoic acid?
butyl hexadecanoate;octadecanoic acid has a molecular weight of 597.02 g/mol, XLogP of 13.14, 33 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl hexadecanoate;octadecanoic acid is sourced from PubChem (CID 87698392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).