About dibutyl octanedioate;heptanoic acid
dibutyl octanedioate;heptanoic acid (PubChem CID 158893161) has the molecular formula C23H44O6
and a molecular weight of 416.60 g/mol. Its IUPAC name is dibutyl octanedioate;heptanoic acid.
Molecular Properties
| Compound Name | dibutyl octanedioate;heptanoic acid |
| PubChem CID | 158893161 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | dibutyl octanedioate;heptanoic acid |
| SMILES | CCCCCCC(=O)O.CCCCOC(=O)CCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C16H30O4.C7H14O2/c1-3-5-13-19-15(17)11-9-7-8-10-12-16(18)20-14-6-4-2;1-2-3-4-5-6-7(8)9/h3-14H2,1-2H3;2-6H2,1H3,(H,8,9) |
| InChIKey | JEMKFADZLKCIPX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutyl octanedioate;heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl octanedioate;heptanoic acid?
The IUPAC name of dibutyl octanedioate;heptanoic acid (CID 158893161) is dibutyl octanedioate;heptanoic acid.
What is the SMILES notation for dibutyl octanedioate;heptanoic acid?
The canonical SMILES for dibutyl octanedioate;heptanoic acid is CCCCCCC(=O)O.CCCCOC(=O)CCCCCCC(=O)OCCCC.
What is the InChIKey of dibutyl octanedioate;heptanoic acid?
The InChIKey is JEMKFADZLKCIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O4.C7H14O2/c1-3-5-13-19-15(17)11-9-7-8-10-12-16(18)20-14-6-4-2;1-2-3-4-5-6-7(8)9/h3-14H2,1-2H3;2-6H2,1H3,(H,8,9).
What are the key properties of dibutyl octanedioate;heptanoic acid?
dibutyl octanedioate;heptanoic acid has a molecular weight of 416.60 g/mol, XLogP of 6.05, 18 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl octanedioate;heptanoic acid is sourced from PubChem (CID 158893161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).