C33H56Br4O12 — CID 153484413
2-[3-[2-(5-bromopentanoyloxy)ethoxy]-2,2-bis[2-(5-bromopentanoyloxy)ethoxymethyl]propoxy]ethyl 5-bromopentanoate (PubChem CID 153484413) has the molecular formula C33H56Br4O12 and a molecular weight of 964.41 g/mol. Its IUPAC name is 2-[3-[2-(5-bromopentanoyloxy)ethoxy]-2,2-bis[2-(5-bromopentanoyloxy)ethoxymethyl]propoxy]ethyl 5-bromopentanoate.
| Compound Name | 2-[3-[2-(5-bromopentanoyloxy)ethoxy]-2,2-bis[2-(5-bromopentanoyloxy)ethoxymethyl]propoxy]ethyl 5-bromopentanoate |
|---|---|
| PubChem CID | 153484413 |
| Molecular Formula | C33H56Br4O12 |
| Molecular Weight | 964.41 g/mol |
| Exact Mass | 960.05 |
| IUPAC Name | 2-[3-[2-(5-bromopentanoyloxy)ethoxy]-2,2-bis[2-(5-bromopentanoyloxy)ethoxymethyl]propoxy]ethyl 5-bromopentanoate |
| SMILES | O=C(CCCCBr)OCCOCC(COCCOC(=O)CCCCBr)(COCCOC(=O)CCCCBr)COCCOC(=O)CCCCBr |
| InChI | InChI=1S/C33H56Br4O12/c34-13-5-1-9-29(38)46-21-17-42-25-33(26-43-18-22-47-30(39)10-2-6-14-35,27-44-19-23-48-31(40)11-3-7-15-36)28-45-20-24-49-32(41)12-4-8-16-37/h1-28H2 |
| InChIKey | JSRVGDJDDHAAAC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|