C33H44O12 — CID 139251858
2-[3-(2-pent-4-ynoyloxyethoxy)-2,2-bis(2-pent-4-ynoyloxyethoxymethyl)propoxy]ethyl pent-4-ynoate (PubChem CID 139251858) has the molecular formula C33H44O12 and a molecular weight of 632.70 g/mol. Its IUPAC name is 2-[3-(2-pent-4-ynoyloxyethoxy)-2,2-bis(2-pent-4-ynoyloxyethoxymethyl)propoxy]ethyl pent-4-ynoate.
| Compound Name | 2-[3-(2-pent-4-ynoyloxyethoxy)-2,2-bis(2-pent-4-ynoyloxyethoxymethyl)propoxy]ethyl pent-4-ynoate |
|---|---|
| PubChem CID | 139251858 |
| Molecular Formula | C33H44O12 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 2-[3-(2-pent-4-ynoyloxyethoxy)-2,2-bis(2-pent-4-ynoyloxyethoxymethyl)propoxy]ethyl pent-4-ynoate |
| SMILES | C#CCCC(=O)OCCOCC(COCCOC(=O)CCC#C)(COCCOC(=O)CCC#C)COCCOC(=O)CCC#C |
| InChI | InChI=1S/C33H44O12/c1-5-9-13-29(34)42-21-17-38-25-33(26-39-18-22-43-30(35)14-10-6-2,27-40-19-23-44-31(36)15-11-7-3)28-41-20-24-45-32(37)16-12-8-4/h1-4H,9-28H2 |
| InChIKey | ZNWMSEOIIAKVDI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|