C30H58N4O17 — CID 153281101
2-[2-[2,2-bis[2-[2-(2-aminoacetyl)oxyethoxy]ethoxymethyl]-3-[2-[2-[(2-aminoacetyl)oxymethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethyl 2-aminoacetate (PubChem CID 153281101) has the molecular formula C30H58N4O17 and a molecular weight of 746.80 g/mol. Its IUPAC name is 2-[2-[2,2-bis[2-[2-(2-aminoacetyl)oxyethoxy]ethoxymethyl]-3-[2-[2-[(2-aminoacetyl)oxymethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethyl 2-aminoacetate.
| Compound Name | 2-[2-[2,2-bis[2-[2-(2-aminoacetyl)oxyethoxy]ethoxymethyl]-3-[2-[2-[(2-aminoacetyl)oxymethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethyl 2-aminoacetate |
|---|---|
| PubChem CID | 153281101 |
| Molecular Formula | C30H58N4O17 |
| Molecular Weight | 746.80 g/mol |
| Exact Mass | 746.38 |
| IUPAC Name | 2-[2-[2,2-bis[2-[2-(2-aminoacetyl)oxyethoxy]ethoxymethyl]-3-[2-[2-[(2-aminoacetyl)oxymethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethyl 2-aminoacetate |
| SMILES | NCC(=O)OCCOCCOCC(COCCOCCOCOC(=O)CN)(COCCOCCOC(=O)CN)COCCOCCOC(=O)CN |
| InChI | InChI=1S/C30H58N4O17/c31-17-26(35)48-14-11-40-2-7-44-22-30(23-45-8-3-41-12-15-49-27(36)18-32,24-46-9-4-42-13-16-50-28(37)19-33)21-43-6-1-39-5-10-47-25-51-29(38)20-34/h1-25,31-34H2 |
| InChIKey | PEMPTIIXZROFGZ-UHFFFAOYSA-N |
| XLogP | -3.91 |
| TPSA | 292.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.80 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|