About 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate
2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate (PubChem CID 87628621) has the molecular formula C10H20N2O5S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate.
Molecular Properties
| Compound Name | 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate |
| PubChem CID | 87628621 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate |
| SMILES | NCC(=O)OCCOCCOC(=O)CNCCS |
| InChI | InChI=1S/C10H20N2O5S/c11-7-9(13)16-4-2-15-3-5-17-10(14)8-12-1-6-18/h12,18H,1-8,11H2 |
| InChIKey | BRUPMTWWVUTABC-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate?
The IUPAC name of 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate (CID 87628621) is 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate.
What is the SMILES notation for 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate?
The canonical SMILES for 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate is NCC(=O)OCCOCCOC(=O)CNCCS.
What is the InChIKey of 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate?
The InChIKey is BRUPMTWWVUTABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O5S/c11-7-9(13)16-4-2-15-3-5-17-10(14)8-12-1-6-18/h12,18H,1-8,11H2.
What are the key properties of 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate?
2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate has a molecular weight of 280.35 g/mol, XLogP of -1.43, 11 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2-sulfanylethylamino)acetyl]oxyethoxy]ethyl 2-aminoacetate is sourced from PubChem (CID 87628621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).