About 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate
2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate (PubChem CID 23187593) has the molecular formula C7H16N2O3S
and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate |
| PubChem CID | 23187593 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate |
| SMILES | CSNCC(=O)OCCOCCN |
| InChI | InChI=1S/C7H16N2O3S/c1-13-9-6-7(10)12-5-4-11-3-2-8/h9H,2-6,8H2,1H3 |
| InChIKey | FGWDJUWODNYCPK-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate?
The IUPAC name of 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate (CID 23187593) is 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate.
What is the SMILES notation for 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate?
The canonical SMILES for 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate is CSNCC(=O)OCCOCCN.
What is the InChIKey of 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate?
The InChIKey is FGWDJUWODNYCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S/c1-13-9-6-7(10)12-5-4-11-3-2-8/h9H,2-6,8H2,1H3.
What are the key properties of 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate?
2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate has a molecular weight of 208.28 g/mol, XLogP of -0.63, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)ethyl 2-(methylsulfanylamino)acetate is sourced from PubChem (CID 23187593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).