C6H12N2O3S — CID 19373954
2-(2-aminoethoxy)ethyl 2-thionitrosoacetate (PubChem CID 19373954) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 2-thionitrosoacetate.
| Compound Name | 2-(2-aminoethoxy)ethyl 2-thionitrosoacetate |
|---|---|
| PubChem CID | 19373954 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 2-thionitrosoacetate |
| SMILES | NCCOCCOC(=O)CN=S |
| InChI | InChI=1S/C6H12N2O3S/c7-1-2-10-3-4-11-6(9)5-8-12/h1-5,7H2 |
| InChIKey | XJMBIKSFVXASHV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|