C14H27NO6 — CID 88876776
prop-2-enyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 88876776) has the molecular formula C14H27NO6 and a molecular weight of 305.37 g/mol. Its IUPAC name is prop-2-enyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | prop-2-enyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 88876776 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | prop-2-enyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | C=CCOC(=O)CCOCCOCCOCCOCCN |
| InChI | InChI=1S/C14H27NO6/c1-2-5-21-14(16)3-6-17-8-10-19-12-13-20-11-9-18-7-4-15/h2H,1,3-13,15H2 |
| InChIKey | FOOWSDRRVCSZGG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|