C20H36O8 — CID 158205428
tert-butyl 4-[2-[2-[2-(3-oxo-3-prop-2-enoxypropoxy)ethoxy]ethoxy]ethoxy]butanoate (PubChem CID 158205428) has the molecular formula C20H36O8 and a molecular weight of 404.50 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-(3-oxo-3-prop-2-enoxypropoxy)ethoxy]ethoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[2-[2-(3-oxo-3-prop-2-enoxypropoxy)ethoxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 158205428 |
| Molecular Formula | C20H36O8 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-(3-oxo-3-prop-2-enoxypropoxy)ethoxy]ethoxy]ethoxy]butanoate |
| SMILES | C=CCOC(=O)CCOCCOCCOCCOCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36O8/c1-5-9-27-18(21)8-11-24-13-15-26-17-16-25-14-12-23-10-6-7-19(22)28-20(2,3)4/h5H,1,6-17H2,2-4H3 |
| InChIKey | MMMLKCFIQDKXNH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|