C10H18O5 — CID 174869989
prop-2-enyl 3-[2-(2-hydroxyethoxy)ethoxy]propanoate (PubChem CID 174869989) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is prop-2-enyl 3-[2-(2-hydroxyethoxy)ethoxy]propanoate.
| Compound Name | prop-2-enyl 3-[2-(2-hydroxyethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 174869989 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | prop-2-enyl 3-[2-(2-hydroxyethoxy)ethoxy]propanoate |
| SMILES | C=CCOC(=O)CCOCCOCCO |
| InChI | InChI=1S/C10H18O5/c1-2-5-15-10(12)3-6-13-8-9-14-7-4-11/h2,11H,1,3-9H2 |
| InChIKey | NLIQJABVXSWJEX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|