C12H22O6 — CID 88876740
prop-2-enyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate (PubChem CID 88876740) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is prop-2-enyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | prop-2-enyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 88876740 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | prop-2-enyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate |
| SMILES | C=CCOC(=O)CCOCCOCCOCCO |
| InChI | InChI=1S/C12H22O6/c1-2-5-18-12(14)3-6-15-8-10-17-11-9-16-7-4-13/h2,13H,1,3-11H2 |
| InChIKey | NWUNFVNJFQFJRL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|