C37H71NO12 — CID 159287274
tert-butyl 5-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]pentanoate;prop-2-enyl 5-[2-[2-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]ethoxy]ethoxy]pentanoate (PubChem CID 159287274) has the molecular formula C37H71NO12 and a molecular weight of 721.97 g/mol. Its IUPAC name is tert-butyl 5-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]pentanoate;prop-2-enyl 5-[2-[2-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]ethoxy]ethoxy]pentanoate.
| Compound Name | tert-butyl 5-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]pentanoate;prop-2-enyl 5-[2-[2-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]ethoxy]ethoxy]pentanoate |
|---|---|
| PubChem CID | 159287274 |
| Molecular Formula | C37H71NO12 |
| Molecular Weight | 721.97 g/mol |
| Exact Mass | 721.50 |
| IUPAC Name | tert-butyl 5-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]pentanoate;prop-2-enyl 5-[2-[2-[5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]ethoxy]ethoxy]pentanoate |
| SMILES | C=CCOC(=O)CCCCOCCOCCOCCCCC(=O)OC(C)(C)C.CC(C)(C)OC(=O)CCCCOCCOCCOCCCN |
| InChI | InChI=1S/C21H38O7.C16H33NO5/c1-5-12-27-19(22)10-6-8-13-24-15-17-26-18-16-25-14-9-7-11-20(23)28-21(2,3)4;1-16(2,3)22-15(18)7-4-5-9-19-11-13-21-14-12-20-10-6-8-17/h5H,1,6-18H2,2-4H3;4-14,17H2,1-3H3 |
| InChIKey | KZQZVNAZQZNVLC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 160.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.97 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|