C21H36O5 — CID 168969824
tert-butyl 6-[2-[2-[(2E)-2-ethenylpenta-2,4-dienoxy]ethoxy]ethoxy]hexanoate (PubChem CID 168969824) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is tert-butyl 6-[2-[2-[(2E)-2-ethenylpenta-2,4-dienoxy]ethoxy]ethoxy]hexanoate.
| Compound Name | tert-butyl 6-[2-[2-[(2E)-2-ethenylpenta-2,4-dienoxy]ethoxy]ethoxy]hexanoate |
|---|---|
| PubChem CID | 168969824 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | tert-butyl 6-[2-[2-[(2E)-2-ethenylpenta-2,4-dienoxy]ethoxy]ethoxy]hexanoate |
| SMILES | C=C/C=C(\C=C)COCCOCCOCCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36O5/c1-6-11-19(7-2)18-25-17-16-24-15-14-23-13-10-8-9-12-20(22)26-21(3,4)5/h6-7,11H,1-2,8-10,12-18H2,3-5H3/b19-11+ |
| InChIKey | LWLCLLGYGJJEAC-YBFXNURJSA-N |
| XLogP | 4.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|