About 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride
2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride (PubChem CID 23187581) has the molecular formula C6H16Cl2N2O2S
and a molecular weight of 251.18 g/mol. Its IUPAC name is 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride.
Molecular Properties
| Compound Name | 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride |
| PubChem CID | 23187581 |
| Molecular Formula | C6H16Cl2N2O2S |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride |
| SMILES | CCSNCC(=O)OCCN.Cl.Cl |
| InChI | InChI=1S/C6H14N2O2S.2ClH/c1-2-11-8-5-6(9)10-4-3-7;;/h8H,2-5,7H2,1H3;2*1H |
| InChIKey | XAOKPFLVYXKCSL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
The IUPAC name of 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride (CID 23187581) is 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride.
What is the SMILES notation for 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
The canonical SMILES for 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride is CCSNCC(=O)OCCN.Cl.Cl.
What is the InChIKey of 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
The InChIKey is XAOKPFLVYXKCSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2S.2ClH/c1-2-11-8-5-6(9)10-4-3-7;;/h8H,2-5,7H2,1H3;2*1H.
What are the key properties of 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride has a molecular weight of 251.18 g/mol, XLogP of 0.59, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2-(ethylsulfanylamino)acetate;dihydrochloride is sourced from PubChem (CID 23187581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).