About 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride
5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride (PubChem CID 23187614) has the molecular formula C9H22Cl2N2O2S
and a molecular weight of 293.26 g/mol. Its IUPAC name is 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride.
Molecular Properties
| Compound Name | 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride |
| PubChem CID | 23187614 |
| Molecular Formula | C9H22Cl2N2O2S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride |
| SMILES | CCSNCC(=O)OCCCCCN.Cl.Cl |
| InChI | InChI=1S/C9H20N2O2S.2ClH/c1-2-14-11-8-9(12)13-7-5-3-4-6-10;;/h11H,2-8,10H2,1H3;2*1H |
| InChIKey | ZHEXXNNAGRVBRG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
The IUPAC name of 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride (CID 23187614) is 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride.
What is the SMILES notation for 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
The canonical SMILES for 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride is CCSNCC(=O)OCCCCCN.Cl.Cl.
What is the InChIKey of 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
The InChIKey is ZHEXXNNAGRVBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2S.2ClH/c1-2-14-11-8-9(12)13-7-5-3-4-6-10;;/h11H,2-8,10H2,1H3;2*1H.
What are the key properties of 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride?
5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride has a molecular weight of 293.26 g/mol, XLogP of 1.76, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentyl 2-(ethylsulfanylamino)acetate;dihydrochloride is sourced from PubChem (CID 23187614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).