About 6-aminohexyl butanoate
6-aminohexyl butanoate (PubChem CID 15683407) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 6-aminohexyl butanoate.
Molecular Properties
| Compound Name | 6-aminohexyl butanoate |
| PubChem CID | 15683407 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 6-aminohexyl butanoate |
| SMILES | CCCC(=O)OCCCCCCN |
| InChI | InChI=1S/C10H21NO2/c1-2-7-10(12)13-9-6-4-3-5-8-11/h2-9,11H2,1H3 |
| InChIKey | UPSUADUWXXXFRO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-aminohexyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminohexyl butanoate?
The IUPAC name of 6-aminohexyl butanoate (CID 15683407) is 6-aminohexyl butanoate.
What is the SMILES notation for 6-aminohexyl butanoate?
The canonical SMILES for 6-aminohexyl butanoate is CCCC(=O)OCCCCCCN.
What is the InChIKey of 6-aminohexyl butanoate?
The InChIKey is UPSUADUWXXXFRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-2-7-10(12)13-9-6-4-3-5-8-11/h2-9,11H2,1H3.
What are the key properties of 6-aminohexyl butanoate?
6-aminohexyl butanoate has a molecular weight of 187.28 g/mol, XLogP of 1.85, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminohexyl butanoate is sourced from PubChem (CID 15683407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).