C33H56Br4O16 — CID 159253551
2-[[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2,2-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 159253551) has the molecular formula C33H56Br4O16 and a molecular weight of 1028.41 g/mol. Its IUPAC name is 2-[[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2,2-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2,2-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 159253551 |
| Molecular Formula | C33H56Br4O16 |
| Molecular Weight | 1028.41 g/mol |
| Exact Mass | 1024.03 |
| IUPAC Name | 2-[[3-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2,2-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCOCOCC(COCOCCOC(=O)C(C)(C)Br)(COCOCCOC(=O)C(C)(C)Br)COCOCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C33H56Br4O16/c1-29(2,34)25(38)50-13-9-42-21-46-17-33(18-47-22-43-10-14-51-26(39)30(3,4)35,19-48-23-44-11-15-52-27(40)31(5,6)36)20-49-24-45-12-16-53-28(41)32(7,8)37/h9-24H2,1-8H3 |
| InChIKey | KVPJAXOVHCZBCG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|