C16H24O6 — CID 160755281
3-[2-(2-but-3-ynoxyethoxy)-2-oxoethyl]-5,5-dimethyl-4-oxohexanoic acid (PubChem CID 160755281) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[2-(2-but-3-ynoxyethoxy)-2-oxoethyl]-5,5-dimethyl-4-oxohexanoic acid.
| Compound Name | 3-[2-(2-but-3-ynoxyethoxy)-2-oxoethyl]-5,5-dimethyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 160755281 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[2-(2-but-3-ynoxyethoxy)-2-oxoethyl]-5,5-dimethyl-4-oxohexanoic acid |
| SMILES | C#CCCOCCOC(=O)CC(CC(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H24O6/c1-5-6-7-21-8-9-22-14(19)11-12(10-13(17)18)15(20)16(2,3)4/h1,12H,6-11H2,2-4H3,(H,17,18) |
| InChIKey | SJGCVFQCLGZYLV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|