About 4-O-but-3-ynyl 1-O-methyl butanedioate
4-O-but-3-ynyl 1-O-methyl butanedioate (PubChem CID 102416271) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-O-but-3-ynyl 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-but-3-ynyl 1-O-methyl butanedioate |
| PubChem CID | 102416271 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-O-but-3-ynyl 1-O-methyl butanedioate |
| SMILES | C#CCCOC(=O)CCC(=O)OC |
| InChI | InChI=1S/C9H12O4/c1-3-4-7-13-9(11)6-5-8(10)12-2/h1H,4-7H2,2H3 |
| InChIKey | XEWYWUIQKYAJLR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-but-3-ynyl 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-but-3-ynyl 1-O-methyl butanedioate?
The IUPAC name of 4-O-but-3-ynyl 1-O-methyl butanedioate (CID 102416271) is 4-O-but-3-ynyl 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-but-3-ynyl 1-O-methyl butanedioate?
The canonical SMILES for 4-O-but-3-ynyl 1-O-methyl butanedioate is C#CCCOC(=O)CCC(=O)OC.
What is the InChIKey of 4-O-but-3-ynyl 1-O-methyl butanedioate?
The InChIKey is XEWYWUIQKYAJLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-3-4-7-13-9(11)6-5-8(10)12-2/h1H,4-7H2,2H3.
What are the key properties of 4-O-but-3-ynyl 1-O-methyl butanedioate?
4-O-but-3-ynyl 1-O-methyl butanedioate has a molecular weight of 184.19 g/mol, XLogP of 0.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-but-3-ynyl 1-O-methyl butanedioate is sourced from PubChem (CID 102416271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).