About but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate
but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate (PubChem CID 177012747) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate.
Molecular Properties
| Compound Name | but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate |
| PubChem CID | 177012747 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate |
| SMILES | C#CCCOC(=O)CCNCCCN(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-4-5-11-16-12(15)7-9-13-8-6-10-14(2)3/h1,13H,5-11H2,2-3H3 |
| InChIKey | XIDNJJKMGIHAQJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate?
The IUPAC name of but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate (CID 177012747) is but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate.
What is the SMILES notation for but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate?
The canonical SMILES for but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate is C#CCCOC(=O)CCNCCCN(C)C.
What is the InChIKey of but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate?
The InChIKey is XIDNJJKMGIHAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-4-5-11-16-12(15)7-9-13-8-6-10-14(2)3/h1,13H,5-11H2,2-3H3.
What are the key properties of but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate?
but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate has a molecular weight of 226.32 g/mol, XLogP of 0.48, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl 3-[3-(dimethylamino)propylamino]propanoate is sourced from PubChem (CID 177012747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).