About but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid
but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid (PubChem CID 177012739) has the molecular formula C21H36N2O4
and a molecular weight of 380.53 g/mol. Its IUPAC name is but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid.
Molecular Properties
| Compound Name | but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid |
| PubChem CID | 177012739 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid |
| SMILES | C#CCCCCN(CCCN(CC)CC)CCC(=O)OCCC#C.O=CO |
| InChI | InChI=1S/C20H34N2O2.CH2O2/c1-5-9-11-12-15-22(17-13-16-21(7-3)8-4)18-14-20(23)24-19-10-6-2;2-1-3/h1-2H,7-19H2,3-4H3;1H,(H,2,3) |
| InChIKey | WPQDIXLFEFIQJX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid?
The IUPAC name of but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid (CID 177012739) is but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid.
What is the SMILES notation for but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid?
The canonical SMILES for but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid is C#CCCCCN(CCCN(CC)CC)CCC(=O)OCCC#C.O=CO.
What is the InChIKey of but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid?
The InChIKey is WPQDIXLFEFIQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O2.CH2O2/c1-5-9-11-12-15-22(17-13-16-21(7-3)8-4)18-14-20(23)24-19-10-6-2;2-1-3/h1-2H,7-19H2,3-4H3;1H,(H,2,3).
What are the key properties of but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid?
but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid has a molecular weight of 380.53 g/mol, XLogP of 2.48, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl 3-[3-(diethylamino)propyl-hex-5-ynylamino]propanoate;formic acid is sourced from PubChem (CID 177012739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).