About 2-(2-propoxyethoxy)ethyl pent-4-ynoate
2-(2-propoxyethoxy)ethyl pent-4-ynoate (PubChem CID 134215375) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(2-propoxyethoxy)ethyl pent-4-ynoate.
Molecular Properties
| Compound Name | 2-(2-propoxyethoxy)ethyl pent-4-ynoate |
| PubChem CID | 134215375 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-(2-propoxyethoxy)ethyl pent-4-ynoate |
| SMILES | C#CCCC(=O)OCCOCCOCCC |
| InChI | InChI=1S/C12H20O4/c1-3-5-6-12(13)16-11-10-15-9-8-14-7-4-2/h1H,4-11H2,2H3 |
| InChIKey | HVYOAVVBXCJQDG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-propoxyethoxy)ethyl pent-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propoxyethoxy)ethyl pent-4-ynoate?
The IUPAC name of 2-(2-propoxyethoxy)ethyl pent-4-ynoate (CID 134215375) is 2-(2-propoxyethoxy)ethyl pent-4-ynoate.
What is the SMILES notation for 2-(2-propoxyethoxy)ethyl pent-4-ynoate?
The canonical SMILES for 2-(2-propoxyethoxy)ethyl pent-4-ynoate is C#CCCC(=O)OCCOCCOCCC.
What is the InChIKey of 2-(2-propoxyethoxy)ethyl pent-4-ynoate?
The InChIKey is HVYOAVVBXCJQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-5-6-12(13)16-11-10-15-9-8-14-7-4-2/h1H,4-11H2,2H3.
What are the key properties of 2-(2-propoxyethoxy)ethyl pent-4-ynoate?
2-(2-propoxyethoxy)ethyl pent-4-ynoate has a molecular weight of 228.29 g/mol, XLogP of 1.39, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propoxyethoxy)ethyl pent-4-ynoate is sourced from PubChem (CID 134215375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).