C15H20O6 — CID 87989282
[2,2-bis(hydroxymethyl)-3-pent-4-ynoyloxypropyl] pent-4-ynoate (PubChem CID 87989282) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is [2,2-bis(hydroxymethyl)-3-pent-4-ynoyloxypropyl] pent-4-ynoate.
| Compound Name | [2,2-bis(hydroxymethyl)-3-pent-4-ynoyloxypropyl] pent-4-ynoate |
|---|---|
| PubChem CID | 87989282 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [2,2-bis(hydroxymethyl)-3-pent-4-ynoyloxypropyl] pent-4-ynoate |
| SMILES | C#CCCC(=O)OCC(CO)(CO)COC(=O)CCC#C |
| InChI | InChI=1S/C15H20O6/c1-3-5-7-13(18)20-11-15(9-16,10-17)12-21-14(19)8-6-4-2/h1-2,16-17H,5-12H2 |
| InChIKey | HHCUOKKLZHMHCW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|