C21H41N7O7 — CID 24861333
2-[4,7-bis(carboxymethyl)-10-[2-(1,5-diaminopentan-3-ylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 24861333) has the molecular formula C21H41N7O7 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-(1,5-diaminopentan-3-ylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-(1,5-diaminopentan-3-ylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 24861333 |
| Molecular Formula | C21H41N7O7 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-(1,5-diaminopentan-3-ylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | NCCC(CCN)NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C21H41N7O7/c22-3-1-17(2-4-23)24-18(29)13-25-5-7-26(14-19(30)31)9-11-28(16-21(34)35)12-10-27(8-6-25)15-20(32)33/h17H,1-16,22-23H2,(H,24,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | AKIMHZAFKUMUJD-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 206.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |