C16H30N6O3 — CID 58262387
CID 58262387 (PubChem CID 58262387) has the molecular formula C16H30N6O3 and a molecular weight of 354.46 g/mol.
| Compound Name | CID 58262387 |
|---|---|
| PubChem CID | 58262387 |
| Molecular Formula | C16H30N6O3 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | — |
| SMILES | [CH]N1CCN([CH])CCN(CC(=O)NCCN)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H30N6O3/c1-19-5-6-20(2)8-10-22(14-16(24)25)12-11-21(9-7-19)13-15(23)18-4-3-17/h1-2H,3-14,17H2,(H,18,23)(H,24,25) |
| InChIKey | MBTGNRINCNYQAZ-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |