C24H45N9O10 — CID 89148034
2-[[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]-10-[2-(carboxymethylamino)-2-oxoethyl]-7-[2-(methylperoxymethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid (PubChem CID 89148034) has the molecular formula C24H45N9O10 and a molecular weight of 619.68 g/mol. Its IUPAC name is 2-[[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]-10-[2-(carboxymethylamino)-2-oxoethyl]-7-[2-(methylperoxymethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]-10-[2-(carboxymethylamino)-2-oxoethyl]-7-[2-(methylperoxymethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 89148034 |
| Molecular Formula | C24H45N9O10 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | 2-[[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]-10-[2-(carboxymethylamino)-2-oxoethyl]-7-[2-(methylperoxymethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid |
| SMILES | COOCNC(=O)CN1CCN(CC(=O)NCCN)CCN(CC(=O)NCC(=O)O)CCN(CC(=O)NCC(=O)O)CC1 |
| InChI | InChI=1S/C24H45N9O10/c1-42-43-18-29-22(37)17-33-10-5-30(14-19(34)26-3-2-25)4-6-31(15-20(35)27-12-23(38)39)7-8-32(9-11-33)16-21(36)28-13-24(40)41/h2-18,25H2,1H3,(H,26,34)(H,27,35)(H,28,36)(H,29,37)(H,38,39)(H,40,41) |
| InChIKey | ZJWWCZYSRJHDQJ-UHFFFAOYSA-N |
| XLogP | -5.66 |
| TPSA | 248.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|