C27H45N7O13 — CID 146484003
5-[(1-amino-4-carboxy-1-oxobutan-2-yl)amino]-5-oxo-4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]pentanoic acid (PubChem CID 146484003) has the molecular formula C27H45N7O13 and a molecular weight of 675.69 g/mol. Its IUPAC name is 5-[(1-amino-4-carboxy-1-oxobutan-2-yl)amino]-5-oxo-4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]pentanoic acid.
| Compound Name | 5-[(1-amino-4-carboxy-1-oxobutan-2-yl)amino]-5-oxo-4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 146484003 |
| Molecular Formula | C27H45N7O13 |
| Molecular Weight | 675.69 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | 5-[(1-amino-4-carboxy-1-oxobutan-2-yl)amino]-5-oxo-4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]pentanoic acid |
| SMILES | NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)CNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C27H45N7O13/c28-26(46)19(2-4-22(38)39)30-27(47)18(1-3-21(36)37)13-29-20(35)14-31-5-7-32(15-23(40)41)9-11-34(17-25(44)45)12-10-33(8-6-31)16-24(42)43/h18-19H,1-17H2,(H2,28,46)(H,29,35)(H,30,47)(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | LINIYHCVKYTCDF-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 300.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.69 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |