C14H20FO6P3 — CID 142037529
2-[[[2-[fluoro-bis(phosphanyl)methyl]phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 142037529) has the molecular formula C14H20FO6P3 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-[[[2-[fluoro-bis(phosphanyl)methyl]phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[[2-[fluoro-bis(phosphanyl)methyl]phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 142037529 |
| Molecular Formula | C14H20FO6P3 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-[[[2-[fluoro-bis(phosphanyl)methyl]phenyl]methyl-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)Cc1ccccc1C(F)(P)P)C(=O)O |
| InChI | InChI=1S/C14H20FO6P3/c15-14(22,23)11-4-2-1-3-9(11)7-24(20,21)8-10(13(18)19)5-6-12(16)17/h1-4,10H,5-8,22-23H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | AUXOHXHHEMYPAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|