C14H17F3NO6P — CID 22460482
2-[[hydroxy-[[3-(trifluoromethyl)anilino]methyl]phosphoryl]methyl]pentanedioic acid (PubChem CID 22460482) has the molecular formula C14H17F3NO6P and a molecular weight of 383.26 g/mol. Its IUPAC name is 2-[[hydroxy-[[3-(trifluoromethyl)anilino]methyl]phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[hydroxy-[[3-(trifluoromethyl)anilino]methyl]phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22460482 |
| Molecular Formula | C14H17F3NO6P |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[[hydroxy-[[3-(trifluoromethyl)anilino]methyl]phosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)CNc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H17F3NO6P/c15-14(16,17)10-2-1-3-11(6-10)18-8-25(23,24)7-9(13(21)22)4-5-12(19)20/h1-3,6,9,18H,4-5,7-8H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | SSLJGKGUDRVZOI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|