C13H15F3NO6P — CID 18472848
2-[[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]amino]pentanedioic acid (PubChem CID 18472848) has the molecular formula C13H15F3NO6P and a molecular weight of 369.23 g/mol. Its IUPAC name is 2-[[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]amino]pentanedioic acid.
| Compound Name | 2-[[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18472848 |
| Molecular Formula | C13H15F3NO6P |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[[hydroxy-[[3-(trifluoromethyl)phenyl]methyl]phosphoryl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NP(=O)(O)Cc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C13H15F3NO6P/c14-13(15,16)9-3-1-2-8(6-9)7-24(22,23)17-10(12(20)21)4-5-11(18)19/h1-3,6,10H,4-5,7H2,(H,18,19)(H,20,21)(H2,17,22,23) |
| InChIKey | YECLUONKYCPSNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|