C20H19F3N2O5 — CID 146629247
(4S)-5-oxo-4-(phenylmethoxycarbonylamino)-5-[3-(trifluoromethyl)anilino]pentanoic acid (PubChem CID 146629247) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is (4S)-5-oxo-4-(phenylmethoxycarbonylamino)-5-[3-(trifluoromethyl)anilino]pentanoic acid.
| Compound Name | (4S)-5-oxo-4-(phenylmethoxycarbonylamino)-5-[3-(trifluoromethyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 146629247 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (4S)-5-oxo-4-(phenylmethoxycarbonylamino)-5-[3-(trifluoromethyl)anilino]pentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O5/c21-20(22,23)14-7-4-8-15(11-14)24-18(28)16(9-10-17(26)27)25-19(29)30-12-13-5-2-1-3-6-13/h1-8,11,16H,9-10,12H2,(H,24,28)(H,25,29)(H,26,27)/t16-/m0/s1 |
| InChIKey | CODSRBRPDUKRBA-INIZCTEOSA-N |
| XLogP | 3.80 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |