C15H21O6P — CID 54106735
2-[[hydroxy-(2,3,4-trimethylphenyl)phosphoryl]methyl]pentanedioic acid (PubChem CID 54106735) has the molecular formula C15H21O6P and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-[[hydroxy-(2,3,4-trimethylphenyl)phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[hydroxy-(2,3,4-trimethylphenyl)phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 54106735 |
| Molecular Formula | C15H21O6P |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[[hydroxy-(2,3,4-trimethylphenyl)phosphoryl]methyl]pentanedioic acid |
| SMILES | Cc1ccc(P(=O)(O)CC(CCC(=O)O)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C15H21O6P/c1-9-4-6-13(11(3)10(9)2)22(20,21)8-12(15(18)19)5-7-14(16)17/h4,6,12H,5,7-8H2,1-3H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | NEGRCQILUDHNAY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|