C13H17FNO6P — CID 22460555
2-[[(2-fluoroanilino)methyl-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 22460555) has the molecular formula C13H17FNO6P and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-[[(2-fluoroanilino)methyl-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[(2-fluoroanilino)methyl-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22460555 |
| Molecular Formula | C13H17FNO6P |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[[(2-fluoroanilino)methyl-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)CNc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C13H17FNO6P/c14-10-3-1-2-4-11(10)15-8-22(20,21)7-9(13(18)19)5-6-12(16)17/h1-4,9,15H,5-8H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | LQEVWDQDCOMKCT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|